C16H9NS — CID 163298313
4-thia-1-azapentacyclo[9.6.1.02,6.07,18.012,17]octadeca-2,5,7,9,11(18),12,14,16-octaene (PubChem CID 163298313) has the molecular formula C16H9NS and a molecular weight of 247.32 g/mol. Its IUPAC name is 4-thia-1-azapentacyclo[9.6.1.02,6.07,18.012,17]octadeca-2,5,7,9,11(18),12,14,16-octaene.
| Compound Name | 4-thia-1-azapentacyclo[9.6.1.02,6.07,18.012,17]octadeca-2,5,7,9,11(18),12,14,16-octaene |
|---|---|
| PubChem CID | 163298313 |
| Molecular Formula | C16H9NS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 4-thia-1-azapentacyclo[9.6.1.02,6.07,18.012,17]octadeca-2,5,7,9,11(18),12,14,16-octaene |
| SMILES | c1ccc2c(c1)c1cccc3c4cscc4n2c13 |
| InChI | InChI=1S/C16H9NS/c1-2-7-14-10(4-1)11-5-3-6-12-13-8-18-9-15(13)17(14)16(11)12/h1-9H |
| InChIKey | IUOMLSAFBREIGX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |