C36H20N2O4 — CID 163521900
15,25-dimethyl-1,5-diazanonacyclo[21.11.1.15,13.02,21.04,19.06,11.027,35.029,34.017,36]hexatriaconta-2(21),3,6,8,10,13(36),14,16,19,23,25,27(35),29,31,33-pentadecaene-12,18,22,28-tetrone (PubChem CID 163521900) has the molecular formula C36H20N2O4 and a molecular weight of 544.57 g/mol. Its IUPAC name is 15,25-dimethyl-1,5-diazanonacyclo[21.11.1.15,13.02,21.04,19.06,11.027,35.029,34.017,36]hexatriaconta-2(21),3,6,8,10,13(36),14,16,19,23,25,27(35),29,31,33-pentadecaene-12,18,22,28-tetrone.
| Compound Name | 15,25-dimethyl-1,5-diazanonacyclo[21.11.1.15,13.02,21.04,19.06,11.027,35.029,34.017,36]hexatriaconta-2(21),3,6,8,10,13(36),14,16,19,23,25,27(35),29,31,33-pentadecaene-12,18,22,28-tetrone |
|---|---|
| PubChem CID | 163521900 |
| Molecular Formula | C36H20N2O4 |
| Molecular Weight | 544.57 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | 15,25-dimethyl-1,5-diazanonacyclo[21.11.1.15,13.02,21.04,19.06,11.027,35.029,34.017,36]hexatriaconta-2(21),3,6,8,10,13(36),14,16,19,23,25,27(35),29,31,33-pentadecaene-12,18,22,28-tetrone |
| SMILES | Cc1cc2c(=O)c3ccccc3n3c4cc5c(cc4c(=O)c(c1)c23)c(=O)c1cc(C)cc2c(=O)c3ccccc3n5c21 |
| InChI | InChI=1S/C36H20N2O4/c1-17-11-23-31-25(13-17)35(41)21-15-22-30(16-29(21)37(31)27-9-5-3-7-19(27)33(23)39)38-28-10-6-4-8-20(28)34(40)24-12-18(2)14-26(32(24)38)36(22)42/h3-16H,1-2H3 |
| InChIKey | JAUGRBWXRWCXTM-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 77.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.57 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|