C18H15NO — CID 139792391
2,4-dimethyl-10-prop-1-ynylacridin-9-one (PubChem CID 139792391) has the molecular formula C18H15NO and a molecular weight of 261.32 g/mol. Its IUPAC name is 2,4-dimethyl-10-prop-1-ynylacridin-9-one.
| Compound Name | 2,4-dimethyl-10-prop-1-ynylacridin-9-one |
|---|---|
| PubChem CID | 139792391 |
| Molecular Formula | C18H15NO |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2,4-dimethyl-10-prop-1-ynylacridin-9-one |
| SMILES | CC#Cn1c2ccccc2c(=O)c2cc(C)cc(C)c21 |
| InChI | InChI=1S/C18H15NO/c1-4-9-19-16-8-6-5-7-14(16)18(20)15-11-12(2)10-13(3)17(15)19/h5-8,10-11H,1-3H3 |
| InChIKey | UWQUBUOVULCGTN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|