C16H11NO — CID 12539302
15-methyl-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaen-8-one (PubChem CID 12539302) has the molecular formula C16H11NO and a molecular weight of 233.27 g/mol. Its IUPAC name is 15-methyl-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaen-8-one.
| Compound Name | 15-methyl-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaen-8-one |
|---|---|
| PubChem CID | 12539302 |
| Molecular Formula | C16H11NO |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 15-methyl-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaen-8-one |
| SMILES | Cc1cc2cccc3c(=O)c4ccccc4n1c23 |
| InChI | InChI=1S/C16H11NO/c1-10-9-11-5-4-7-13-15(11)17(10)14-8-3-2-6-12(14)16(13)18/h2-9H,1H3 |
| InChIKey | VNZRZEGQFFZDKT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 21.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|