C30H31AgN2O2 — CID 160615456
silver;1,3-bis(2,4,6-trimethylphenyl)-2H-benzo[f]benzimidazol-2-ide-4,9-dione;methane (PubChem CID 160615456) has the molecular formula C30H31AgN2O2 and a molecular weight of 559.46 g/mol. Its IUPAC name is silver;1,3-bis(2,4,6-trimethylphenyl)-2H-benzo[f]benzimidazol-2-ide-4,9-dione;methane.
| Compound Name | silver;1,3-bis(2,4,6-trimethylphenyl)-2H-benzo[f]benzimidazol-2-ide-4,9-dione;methane |
|---|---|
| PubChem CID | 160615456 |
| Molecular Formula | C30H31AgN2O2 |
| Molecular Weight | 559.46 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | silver;1,3-bis(2,4,6-trimethylphenyl)-2H-benzo[f]benzimidazol-2-ide-4,9-dione;methane |
| SMILES | C.Cc1cc(C)c(-n2[cH-]n(-c3c(C)cc(C)cc3C)c3c(=O)c4ccccc4c(=O)c2=3)c(C)c1.[Ag+] |
| InChI | InChI=1S/C29H27N2O2.CH4.Ag/c1-16-11-18(3)24(19(4)12-16)30-15-31(25-20(5)13-17(2)14-21(25)6)27-26(30)28(32)22-9-7-8-10-23(22)29(27)33;;/h7-15H,1-6H3;1H4;/q-1;;+1 |
| InChIKey | PVWWNVISOHHQML-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.46 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|