C26H33N3O2 — CID 4859324
4-[3-(diethylamino)propyliminomethyl]-3-hydroxy-2-(2,4,6-trimethylphenyl)isoquinolin-1-one (PubChem CID 4859324) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 4-[3-(diethylamino)propyliminomethyl]-3-hydroxy-2-(2,4,6-trimethylphenyl)isoquinolin-1-one.
| Compound Name | 4-[3-(diethylamino)propyliminomethyl]-3-hydroxy-2-(2,4,6-trimethylphenyl)isoquinolin-1-one |
|---|---|
| PubChem CID | 4859324 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 4-[3-(diethylamino)propyliminomethyl]-3-hydroxy-2-(2,4,6-trimethylphenyl)isoquinolin-1-one |
| SMILES | CCN(CC)CCC/N=C/c1c(O)n(-c2c(C)cc(C)cc2C)c(=O)c2ccccc12 |
| InChI | InChI=1S/C26H33N3O2/c1-6-28(7-2)14-10-13-27-17-23-21-11-8-9-12-22(21)25(30)29(26(23)31)24-19(4)15-18(3)16-20(24)5/h8-9,11-12,15-17,31H,6-7,10,13-14H2,1-5H3/b27-17+ |
| InChIKey | ROBAQYWDGGJRRO-WPWMEQJKSA-N |
| XLogP | 4.77 |
| TPSA | 57.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|