C25H29N3O2 — CID 2030864
2-(3,5-dimethylphenyl)-4-[[(2R)-1-ethylpyrrolidin-2-yl]methyliminomethyl]-3-hydroxyisoquinolin-1-one (PubChem CID 2030864) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-4-[[(2R)-1-ethylpyrrolidin-2-yl]methyliminomethyl]-3-hydroxyisoquinolin-1-one.
| Compound Name | 2-(3,5-dimethylphenyl)-4-[[(2R)-1-ethylpyrrolidin-2-yl]methyliminomethyl]-3-hydroxyisoquinolin-1-one |
|---|---|
| PubChem CID | 2030864 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-4-[[(2R)-1-ethylpyrrolidin-2-yl]methyliminomethyl]-3-hydroxyisoquinolin-1-one |
| SMILES | CCN1CCC[C@@H]1C/N=C/c1c(O)n(-c2cc(C)cc(C)c2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C25H29N3O2/c1-4-27-11-7-8-19(27)15-26-16-23-21-9-5-6-10-22(21)24(29)28(25(23)30)20-13-17(2)12-18(3)14-20/h5-6,9-10,12-14,16,19,30H,4,7-8,11,15H2,1-3H3/b26-16+/t19-/m1/s1 |
| InChIKey | VQAQCQKXQXDKOS-DZTFFZQKSA-N |
| XLogP | 4.22 |
| TPSA | 57.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|