C29H29N3O3 — CID 135600533
2-(4-ethoxyphenyl)-3-hydroxy-4-[(2-piperidin-1-ylphenyl)iminomethyl]isoquinolin-1-one (PubChem CID 135600533) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-3-hydroxy-4-[(2-piperidin-1-ylphenyl)iminomethyl]isoquinolin-1-one.
| Compound Name | 2-(4-ethoxyphenyl)-3-hydroxy-4-[(2-piperidin-1-ylphenyl)iminomethyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 135600533 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 2-(4-ethoxyphenyl)-3-hydroxy-4-[(2-piperidin-1-ylphenyl)iminomethyl]isoquinolin-1-one |
| SMILES | CCOc1ccc(-n2c(O)c(/C=N/c3ccccc3N3CCCCC3)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C29H29N3O3/c1-2-35-22-16-14-21(15-17-22)32-28(33)24-11-5-4-10-23(24)25(29(32)34)20-30-26-12-6-7-13-27(26)31-18-8-3-9-19-31/h4-7,10-17,20,34H,2-3,8-9,18-19H2,1H3/b30-20+ |
| InChIKey | VWGFDWZCJNQIBQ-TWKHWXDSSA-N |
| XLogP | 5.84 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|