C29H27N3O5 — CID 3603965
ethyl 4-[3-hydroxy-4-[(4-morpholin-4-ylphenyl)iminomethyl]-1-oxoisoquinolin-2-yl]benzoate (PubChem CID 3603965) has the molecular formula C29H27N3O5 and a molecular weight of 497.55 g/mol. Its IUPAC name is ethyl 4-[3-hydroxy-4-[(4-morpholin-4-ylphenyl)iminomethyl]-1-oxoisoquinolin-2-yl]benzoate.
| Compound Name | ethyl 4-[3-hydroxy-4-[(4-morpholin-4-ylphenyl)iminomethyl]-1-oxoisoquinolin-2-yl]benzoate |
|---|---|
| PubChem CID | 3603965 |
| Molecular Formula | C29H27N3O5 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | ethyl 4-[3-hydroxy-4-[(4-morpholin-4-ylphenyl)iminomethyl]-1-oxoisoquinolin-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(O)c(/C=N/c3ccc(N4CCOCC4)cc3)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C29H27N3O5/c1-2-37-29(35)20-7-11-23(12-8-20)32-27(33)25-6-4-3-5-24(25)26(28(32)34)19-30-21-9-13-22(14-10-21)31-15-17-36-18-16-31/h3-14,19,34H,2,15-18H2,1H3/b30-19+ |
| InChIKey | BTCHXILIVKOAQD-NDZAJKAJSA-N |
| XLogP | 4.46 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|