C29H23N5O6S — CID 2489201
ethyl 4-[3-hydroxy-1-oxo-4-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]iminomethyl]isoquinolin-2-yl]benzoate (PubChem CID 2489201) has the molecular formula C29H23N5O6S and a molecular weight of 569.60 g/mol. Its IUPAC name is ethyl 4-[3-hydroxy-1-oxo-4-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]iminomethyl]isoquinolin-2-yl]benzoate.
| Compound Name | ethyl 4-[3-hydroxy-1-oxo-4-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]iminomethyl]isoquinolin-2-yl]benzoate |
|---|---|
| PubChem CID | 2489201 |
| Molecular Formula | C29H23N5O6S |
| Molecular Weight | 569.60 g/mol |
| Exact Mass | 569.14 |
| IUPAC Name | ethyl 4-[3-hydroxy-1-oxo-4-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]iminomethyl]isoquinolin-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(O)c(/C=N/c3ccc(S(=O)(=O)Nc4ncccn4)cc3)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C29H23N5O6S/c1-2-40-28(37)19-8-12-21(13-9-19)34-26(35)24-7-4-3-6-23(24)25(27(34)36)18-32-20-10-14-22(15-11-20)41(38,39)33-29-30-16-5-17-31-29/h3-18,36H,2H2,1H3,(H,30,31,33)/b32-18+ |
| InChIKey | TUNYZSXVPJFSBO-KCSSXMTESA-N |
| XLogP | 4.21 |
| TPSA | 152.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|