C29H28ClN3O6S — CID 4832301
ethyl 4-[4-[[2-chloro-5-(diethylsulfamoyl)phenyl]iminomethyl]-3-hydroxy-1-oxoisoquinolin-2-yl]benzoate (PubChem CID 4832301) has the molecular formula C29H28ClN3O6S and a molecular weight of 582.08 g/mol. Its IUPAC name is ethyl 4-[4-[[2-chloro-5-(diethylsulfamoyl)phenyl]iminomethyl]-3-hydroxy-1-oxoisoquinolin-2-yl]benzoate.
| Compound Name | ethyl 4-[4-[[2-chloro-5-(diethylsulfamoyl)phenyl]iminomethyl]-3-hydroxy-1-oxoisoquinolin-2-yl]benzoate |
|---|---|
| PubChem CID | 4832301 |
| Molecular Formula | C29H28ClN3O6S |
| Molecular Weight | 582.08 g/mol |
| Exact Mass | 581.14 |
| IUPAC Name | ethyl 4-[4-[[2-chloro-5-(diethylsulfamoyl)phenyl]iminomethyl]-3-hydroxy-1-oxoisoquinolin-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(O)c(/C=N/c3cc(S(=O)(=O)N(CC)CC)ccc3Cl)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C29H28ClN3O6S/c1-4-32(5-2)40(37,38)21-15-16-25(30)26(17-21)31-18-24-22-9-7-8-10-23(22)27(34)33(28(24)35)20-13-11-19(12-14-20)29(36)39-6-3/h7-18,35H,4-6H2,1-3H3/b31-18+ |
| InChIKey | LFYSZRJILYBPGG-FDAWAROLSA-N |
| XLogP | 5.31 |
| TPSA | 118.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.08 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|