C27H25ClN4O5S — CID 135432466
4-chloro-N-[(E)-[2-[3-(diethylsulfamoyl)phenyl]-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]benzamide (PubChem CID 135432466) has the molecular formula C27H25ClN4O5S and a molecular weight of 553.04 g/mol. Its IUPAC name is 4-chloro-N-[(E)-[2-[3-(diethylsulfamoyl)phenyl]-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]benzamide.
| Compound Name | 4-chloro-N-[(E)-[2-[3-(diethylsulfamoyl)phenyl]-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 135432466 |
| Molecular Formula | C27H25ClN4O5S |
| Molecular Weight | 553.04 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | 4-chloro-N-[(E)-[2-[3-(diethylsulfamoyl)phenyl]-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(-n2c(O)c(/C=N/NC(=O)c3ccc(Cl)cc3)c3ccccc3c2=O)c1 |
| InChI | InChI=1S/C27H25ClN4O5S/c1-3-31(4-2)38(36,37)21-9-7-8-20(16-21)32-26(34)23-11-6-5-10-22(23)24(27(32)35)17-29-30-25(33)18-12-14-19(28)15-13-18/h5-17,35H,3-4H2,1-2H3,(H,30,33)/b29-17+ |
| InChIKey | MPKZPJRBTWZOLV-STBIYBPSSA-N |
| XLogP | 4.14 |
| TPSA | 121.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.04 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|