C24H15ClF3N3O3 — CID 5113602
4-chloro-N-[[3-hydroxy-1-oxo-2-[2-(trifluoromethyl)phenyl]isoquinolin-4-yl]methylideneamino]benzamide (PubChem CID 5113602) has the molecular formula C24H15ClF3N3O3 and a molecular weight of 485.85 g/mol. Its IUPAC name is 4-chloro-N-[[3-hydroxy-1-oxo-2-[2-(trifluoromethyl)phenyl]isoquinolin-4-yl]methylideneamino]benzamide.
| Compound Name | 4-chloro-N-[[3-hydroxy-1-oxo-2-[2-(trifluoromethyl)phenyl]isoquinolin-4-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 5113602 |
| Molecular Formula | C24H15ClF3N3O3 |
| Molecular Weight | 485.85 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 4-chloro-N-[[3-hydroxy-1-oxo-2-[2-(trifluoromethyl)phenyl]isoquinolin-4-yl]methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1c(O)n(-c2ccccc2C(F)(F)F)c(=O)c2ccccc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H15ClF3N3O3/c25-15-11-9-14(10-12-15)21(32)30-29-13-18-16-5-1-2-6-17(16)22(33)31(23(18)34)20-8-4-3-7-19(20)24(26,27)28/h1-13,34H,(H,30,32) |
| InChIKey | ZQMAERUOKSZTEW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 83.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.85 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|