C23H13Cl2F3N2O2 — CID 2320257
4-[(2,5-dichlorophenyl)iminomethyl]-3-hydroxy-2-[2-(trifluoromethyl)phenyl]isoquinolin-1-one (PubChem CID 2320257) has the molecular formula C23H13Cl2F3N2O2 and a molecular weight of 477.27 g/mol. Its IUPAC name is 4-[(2,5-dichlorophenyl)iminomethyl]-3-hydroxy-2-[2-(trifluoromethyl)phenyl]isoquinolin-1-one.
| Compound Name | 4-[(2,5-dichlorophenyl)iminomethyl]-3-hydroxy-2-[2-(trifluoromethyl)phenyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 2320257 |
| Molecular Formula | C23H13Cl2F3N2O2 |
| Molecular Weight | 477.27 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | 4-[(2,5-dichlorophenyl)iminomethyl]-3-hydroxy-2-[2-(trifluoromethyl)phenyl]isoquinolin-1-one |
| SMILES | O=c1c2ccccc2c(/C=N/c2cc(Cl)ccc2Cl)c(O)n1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C23H13Cl2F3N2O2/c24-13-9-10-18(25)19(11-13)29-12-16-14-5-1-2-6-15(14)21(31)30(22(16)32)20-8-4-3-7-17(20)23(26,27)28/h1-12,32H/b29-12+ |
| InChIKey | XBXFZDYWSPYVLV-XKJRVUDJSA-N |
| XLogP | 6.77 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.27 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|