C20H14F3N3O2S — CID 2310288
4-(4,5-dihydro-1,3-thiazol-2-yliminomethyl)-3-hydroxy-2-[2-(trifluoromethyl)phenyl]isoquinolin-1-one (PubChem CID 2310288) has the molecular formula C20H14F3N3O2S and a molecular weight of 417.41 g/mol. Its IUPAC name is 4-(4,5-dihydro-1,3-thiazol-2-yliminomethyl)-3-hydroxy-2-[2-(trifluoromethyl)phenyl]isoquinolin-1-one.
| Compound Name | 4-(4,5-dihydro-1,3-thiazol-2-yliminomethyl)-3-hydroxy-2-[2-(trifluoromethyl)phenyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 2310288 |
| Molecular Formula | C20H14F3N3O2S |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 4-(4,5-dihydro-1,3-thiazol-2-yliminomethyl)-3-hydroxy-2-[2-(trifluoromethyl)phenyl]isoquinolin-1-one |
| SMILES | O=c1c2ccccc2c(C=NC2=NCCS2)c(O)n1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H14F3N3O2S/c21-20(22,23)15-7-3-4-8-16(15)26-17(27)13-6-2-1-5-12(13)14(18(26)28)11-25-19-24-9-10-29-19/h1-8,11,28H,9-10H2 |
| InChIKey | RQHIWZKXOVIJKV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 66.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|