C23H22N4O5S2 — CID 4850387
4-(4,5-dihydro-1,3-thiazol-2-yliminomethyl)-3-hydroxy-2-(4-morpholin-4-ylsulfonylphenyl)isoquinolin-1-one (PubChem CID 4850387) has the molecular formula C23H22N4O5S2 and a molecular weight of 498.59 g/mol. Its IUPAC name is 4-(4,5-dihydro-1,3-thiazol-2-yliminomethyl)-3-hydroxy-2-(4-morpholin-4-ylsulfonylphenyl)isoquinolin-1-one.
| Compound Name | 4-(4,5-dihydro-1,3-thiazol-2-yliminomethyl)-3-hydroxy-2-(4-morpholin-4-ylsulfonylphenyl)isoquinolin-1-one |
|---|---|
| PubChem CID | 4850387 |
| Molecular Formula | C23H22N4O5S2 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | 4-(4,5-dihydro-1,3-thiazol-2-yliminomethyl)-3-hydroxy-2-(4-morpholin-4-ylsulfonylphenyl)isoquinolin-1-one |
| SMILES | O=c1c2ccccc2c(C=NC2=NCCS2)c(O)n1-c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H22N4O5S2/c28-21-19-4-2-1-3-18(19)20(15-25-23-24-9-14-33-23)22(29)27(21)16-5-7-17(8-6-16)34(30,31)26-10-12-32-13-11-26/h1-8,15,29H,9-14H2 |
| InChIKey | LEDQGSZZUVMVAA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 113.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|