C21H20N4O6S — CID 2878941
6-hydroxy-5-[(4-morpholin-4-ylsulfonylphenyl)iminomethyl]-1-phenylpyrimidine-2,4-dione (PubChem CID 2878941) has the molecular formula C21H20N4O6S and a molecular weight of 456.48 g/mol. Its IUPAC name is 6-hydroxy-5-[(4-morpholin-4-ylsulfonylphenyl)iminomethyl]-1-phenylpyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[(4-morpholin-4-ylsulfonylphenyl)iminomethyl]-1-phenylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2878941 |
| Molecular Formula | C21H20N4O6S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 6-hydroxy-5-[(4-morpholin-4-ylsulfonylphenyl)iminomethyl]-1-phenylpyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2ccccc2)c(O)c1/C=N/c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H20N4O6S/c26-19-18(20(27)25(21(28)23-19)16-4-2-1-3-5-16)14-22-15-6-8-17(9-7-15)32(29,30)24-10-12-31-13-11-24/h1-9,14,27H,10-13H2,(H,23,26,28)/b22-14+ |
| InChIKey | FENNYZXRQQCJCI-HYARGMPZSA-N |
| XLogP | 1.00 |
| TPSA | 134.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|