C28H30N4O6S2 — CID 4105745
N-(4-morpholin-4-ylsulfonylphenyl)-1-[3-[(4-morpholin-4-ylsulfonylphenyl)iminomethyl]phenyl]methanimine (PubChem CID 4105745) has the molecular formula C28H30N4O6S2 and a molecular weight of 582.70 g/mol. Its IUPAC name is N-(4-morpholin-4-ylsulfonylphenyl)-1-[3-[(4-morpholin-4-ylsulfonylphenyl)iminomethyl]phenyl]methanimine.
| Compound Name | N-(4-morpholin-4-ylsulfonylphenyl)-1-[3-[(4-morpholin-4-ylsulfonylphenyl)iminomethyl]phenyl]methanimine |
|---|---|
| PubChem CID | 4105745 |
| Molecular Formula | C28H30N4O6S2 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | N-(4-morpholin-4-ylsulfonylphenyl)-1-[3-[(4-morpholin-4-ylsulfonylphenyl)iminomethyl]phenyl]methanimine |
| SMILES | O=S(=O)(c1ccc(/N=C/c2cccc(/C=N/c3ccc(S(=O)(=O)N4CCOCC4)cc3)c2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C28H30N4O6S2/c33-39(34,31-12-16-37-17-13-31)27-8-4-25(5-9-27)29-21-23-2-1-3-24(20-23)22-30-26-6-10-28(11-7-26)40(35,36)32-14-18-38-19-15-32/h1-11,20-22H,12-19H2/b29-21+,30-22+ |
| InChIKey | AFJJMAHKSGAGCD-VFIVCBTMSA-N |
| XLogP | 3.23 |
| TPSA | 117.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|