C19H22N2O5S — CID 135812287
5-ethoxy-2-[(4-morpholin-4-ylsulfonylphenyl)iminomethyl]phenol (PubChem CID 135812287) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is 5-ethoxy-2-[(4-morpholin-4-ylsulfonylphenyl)iminomethyl]phenol.
| Compound Name | 5-ethoxy-2-[(4-morpholin-4-ylsulfonylphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 135812287 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 5-ethoxy-2-[(4-morpholin-4-ylsulfonylphenyl)iminomethyl]phenol |
| SMILES | CCOc1ccc(/C=N/c2ccc(S(=O)(=O)N3CCOCC3)cc2)c(O)c1 |
| InChI | InChI=1S/C19H22N2O5S/c1-2-26-17-6-3-15(19(22)13-17)14-20-16-4-7-18(8-5-16)27(23,24)21-9-11-25-12-10-21/h3-8,13-14,22H,2,9-12H2,1H3/b20-14+ |
| InChIKey | WUOXOKJCKHFQOR-XSFVSMFZSA-N |
| XLogP | 2.56 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|