C18H20N2O4S — CID 4512993
4-[(4-piperidin-1-ylsulfonylphenyl)iminomethyl]benzene-1,3-diol (PubChem CID 4512993) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 4-[(4-piperidin-1-ylsulfonylphenyl)iminomethyl]benzene-1,3-diol.
| Compound Name | 4-[(4-piperidin-1-ylsulfonylphenyl)iminomethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 4512993 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 4-[(4-piperidin-1-ylsulfonylphenyl)iminomethyl]benzene-1,3-diol |
| SMILES | O=S(=O)(c1ccc(/N=C/c2ccc(O)cc2O)cc1)N1CCCCC1 |
| InChI | InChI=1S/C18H20N2O4S/c21-16-7-4-14(18(22)12-16)13-19-15-5-8-17(9-6-15)25(23,24)20-10-2-1-3-11-20/h4-9,12-13,21-22H,1-3,10-11H2/b19-13+ |
| InChIKey | ZLIIASIRADGKFT-CPNJWEJPSA-N |
| XLogP | 3.02 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|