C19H22N2O2S — CID 910303
1-(2-methylphenyl)-N-(4-piperidin-1-ylsulfonylphenyl)methanimine (PubChem CID 910303) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is 1-(2-methylphenyl)-N-(4-piperidin-1-ylsulfonylphenyl)methanimine.
| Compound Name | 1-(2-methylphenyl)-N-(4-piperidin-1-ylsulfonylphenyl)methanimine |
|---|---|
| PubChem CID | 910303 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-(2-methylphenyl)-N-(4-piperidin-1-ylsulfonylphenyl)methanimine |
| SMILES | Cc1ccccc1/C=N/c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H22N2O2S/c1-16-7-3-4-8-17(16)15-20-18-9-11-19(12-10-18)24(22,23)21-13-5-2-6-14-21/h3-4,7-12,15H,2,5-6,13-14H2,1H3/b20-15+ |
| InChIKey | BVFSWKBTMNLEFH-HMMYKYKNSA-N |
| XLogP | 3.92 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|