C25H22N4O2 — CID 135709408
3-hydroxy-2-pyridin-2-yl-4-[(4-pyrrolidin-1-ylphenyl)iminomethyl]isoquinolin-1-one (PubChem CID 135709408) has the molecular formula C25H22N4O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 3-hydroxy-2-pyridin-2-yl-4-[(4-pyrrolidin-1-ylphenyl)iminomethyl]isoquinolin-1-one.
| Compound Name | 3-hydroxy-2-pyridin-2-yl-4-[(4-pyrrolidin-1-ylphenyl)iminomethyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 135709408 |
| Molecular Formula | C25H22N4O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 3-hydroxy-2-pyridin-2-yl-4-[(4-pyrrolidin-1-ylphenyl)iminomethyl]isoquinolin-1-one |
| SMILES | O=c1c2ccccc2c(/C=N/c2ccc(N3CCCC3)cc2)c(O)n1-c1ccccn1 |
| InChI | InChI=1S/C25H22N4O2/c30-24-21-8-2-1-7-20(21)22(25(31)29(24)23-9-3-4-14-26-23)17-27-18-10-12-19(13-11-18)28-15-5-6-16-28/h1-4,7-14,17,31H,5-6,15-16H2/b27-17+ |
| InChIKey | IGUZTDSWYJMLQC-WPWMEQJKSA-N |
| XLogP | 4.44 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|