C19H15N5O2S2 — CID 135709306
4-[(E)-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)iminomethyl]-3-hydroxy-2-pyridin-2-ylisoquinolin-1-one (PubChem CID 135709306) has the molecular formula C19H15N5O2S2 and a molecular weight of 409.50 g/mol. Its IUPAC name is 4-[(E)-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)iminomethyl]-3-hydroxy-2-pyridin-2-ylisoquinolin-1-one.
| Compound Name | 4-[(E)-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)iminomethyl]-3-hydroxy-2-pyridin-2-ylisoquinolin-1-one |
|---|---|
| PubChem CID | 135709306 |
| Molecular Formula | C19H15N5O2S2 |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 4-[(E)-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)iminomethyl]-3-hydroxy-2-pyridin-2-ylisoquinolin-1-one |
| SMILES | CCSc1nnc(/N=C/c2c(O)n(-c3ccccn3)c(=O)c3ccccc23)s1 |
| InChI | InChI=1S/C19H15N5O2S2/c1-2-27-19-23-22-18(28-19)21-11-14-12-7-3-4-8-13(12)16(25)24(17(14)26)15-9-5-6-10-20-15/h3-11,26H,2H2,1H3/b21-11+ |
| InChIKey | XZFCZAINBGBKOH-SRZZPIQSSA-N |
| XLogP | 3.81 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|