C22H20N4O3S — CID 135854631
2-(4-ethoxyphenyl)-4-[(E)-(5-ethyl-1,3,4-thiadiazol-2-yl)iminomethyl]-3-hydroxyisoquinolin-1-one (PubChem CID 135854631) has the molecular formula C22H20N4O3S and a molecular weight of 420.49 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-4-[(E)-(5-ethyl-1,3,4-thiadiazol-2-yl)iminomethyl]-3-hydroxyisoquinolin-1-one.
| Compound Name | 2-(4-ethoxyphenyl)-4-[(E)-(5-ethyl-1,3,4-thiadiazol-2-yl)iminomethyl]-3-hydroxyisoquinolin-1-one |
|---|---|
| PubChem CID | 135854631 |
| Molecular Formula | C22H20N4O3S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 2-(4-ethoxyphenyl)-4-[(E)-(5-ethyl-1,3,4-thiadiazol-2-yl)iminomethyl]-3-hydroxyisoquinolin-1-one |
| SMILES | CCOc1ccc(-n2c(O)c(/C=N/c3nnc(CC)s3)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C22H20N4O3S/c1-3-19-24-25-22(30-19)23-13-18-16-7-5-6-8-17(16)20(27)26(21(18)28)14-9-11-15(12-10-14)29-4-2/h5-13,28H,3-4H2,1-2H3/b23-13+ |
| InChIKey | YCHDOHZWJJRQRL-YDZHTSKRSA-N |
| XLogP | 4.26 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|