C29H28N4O4 — CID 2542666
2-(3,4-dihydro-2H-quinolin-1-yl)-N-[[2-(4-ethoxyphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]acetamide (PubChem CID 2542666) has the molecular formula C29H28N4O4 and a molecular weight of 496.57 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-quinolin-1-yl)-N-[[2-(4-ethoxyphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]acetamide.
| Compound Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-N-[[2-(4-ethoxyphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 2542666 |
| Molecular Formula | C29H28N4O4 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-N-[[2-(4-ethoxyphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]acetamide |
| SMILES | CCOc1ccc(-n2c(O)c(C=NNC(=O)CN3CCCc4ccccc43)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C29H28N4O4/c1-2-37-22-15-13-21(14-16-22)33-28(35)24-11-5-4-10-23(24)25(29(33)36)18-30-31-27(34)19-32-17-7-9-20-8-3-6-12-26(20)32/h3-6,8,10-16,18,36H,2,7,9,17,19H2,1H3,(H,31,34) |
| InChIKey | ISNZIKJCTKMKQY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|