C40H36N6O6 — CID 135555649
N,N'-bis[(E)-[3-hydroxy-2-(4-methylphenyl)-1-oxoisoquinolin-4-yl]methylideneamino]hexanediamide (PubChem CID 135555649) has the molecular formula C40H36N6O6 and a molecular weight of 696.76 g/mol. Its IUPAC name is N,N'-bis[(E)-[3-hydroxy-2-(4-methylphenyl)-1-oxoisoquinolin-4-yl]methylideneamino]hexanediamide.
| Compound Name | N,N'-bis[(E)-[3-hydroxy-2-(4-methylphenyl)-1-oxoisoquinolin-4-yl]methylideneamino]hexanediamide |
|---|---|
| PubChem CID | 135555649 |
| Molecular Formula | C40H36N6O6 |
| Molecular Weight | 696.76 g/mol |
| Exact Mass | 696.27 |
| IUPAC Name | N,N'-bis[(E)-[3-hydroxy-2-(4-methylphenyl)-1-oxoisoquinolin-4-yl]methylideneamino]hexanediamide |
| SMILES | Cc1ccc(-n2c(O)c(/C=N/NC(=O)CCCCC(=O)N/N=C/c3c(O)n(-c4ccc(C)cc4)c(=O)c4ccccc34)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C40H36N6O6/c1-25-15-19-27(20-16-25)45-37(49)31-11-5-3-9-29(31)33(39(45)51)23-41-43-35(47)13-7-8-14-36(48)44-42-24-34-30-10-4-6-12-32(30)38(50)46(40(34)52)28-21-17-26(2)18-22-28/h3-6,9-12,15-24,51-52H,7-8,13-14H2,1-2H3,(H,43,47)(H,44,48)/b41-23+,42-24+ |
| InChIKey | UVBBZTAOGMCBTO-WAJJMWJGSA-N |
| XLogP | 5.48 |
| TPSA | 167.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.76 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|