C22H23N3O5 — CID 135466290
N-[(E)-[2-(3,4-dimethoxyphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]-2-methylpropanamide (PubChem CID 135466290) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is N-[(E)-[2-(3,4-dimethoxyphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]-2-methylpropanamide.
| Compound Name | N-[(E)-[2-(3,4-dimethoxyphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]-2-methylpropanamide |
|---|---|
| PubChem CID | 135466290 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-[(E)-[2-(3,4-dimethoxyphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]-2-methylpropanamide |
| SMILES | COc1ccc(-n2c(O)c(/C=N/NC(=O)C(C)C)c3ccccc3c2=O)cc1OC |
| InChI | InChI=1S/C22H23N3O5/c1-13(2)20(26)24-23-12-17-15-7-5-6-8-16(15)21(27)25(22(17)28)14-9-10-18(29-3)19(11-14)30-4/h5-13,28H,1-4H3,(H,24,26)/b23-12+ |
| InChIKey | QLMGWZUFOPRZPK-FSJBWODESA-N |
| XLogP | 2.82 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|