C19H16N6O4 — CID 135911674
2-(3,4-dimethoxyphenyl)-3-hydroxy-4-[(E)-2H-tetrazol-5-yliminomethyl]isoquinolin-1-one (PubChem CID 135911674) has the molecular formula C19H16N6O4 and a molecular weight of 392.38 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-3-hydroxy-4-[(E)-2H-tetrazol-5-yliminomethyl]isoquinolin-1-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-3-hydroxy-4-[(E)-2H-tetrazol-5-yliminomethyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 135911674 |
| Molecular Formula | C19H16N6O4 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-3-hydroxy-4-[(E)-2H-tetrazol-5-yliminomethyl]isoquinolin-1-one |
| SMILES | COc1ccc(-n2c(O)c(/C=N/c3nn[nH]n3)c3ccccc3c2=O)cc1OC |
| InChI | InChI=1S/C19H16N6O4/c1-28-15-8-7-11(9-16(15)29-2)25-17(26)13-6-4-3-5-12(13)14(18(25)27)10-20-19-21-23-24-22-19/h3-10,27H,1-2H3,(H,21,22,23,24)/b20-10+ |
| InChIKey | RWUPJIPXIGWAKF-KEBDBYFISA-N |
| XLogP | 1.98 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|