C25H20N4O4 — CID 4885261
2-(3,4-dimethoxyphenyl)-3-hydroxy-4-(1H-indazol-5-yliminomethyl)isoquinolin-1-one (PubChem CID 4885261) has the molecular formula C25H20N4O4 and a molecular weight of 440.46 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-3-hydroxy-4-(1H-indazol-5-yliminomethyl)isoquinolin-1-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-3-hydroxy-4-(1H-indazol-5-yliminomethyl)isoquinolin-1-one |
|---|---|
| PubChem CID | 4885261 |
| Molecular Formula | C25H20N4O4 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-3-hydroxy-4-(1H-indazol-5-yliminomethyl)isoquinolin-1-one |
| SMILES | COc1ccc(-n2c(O)c(/C=N/c3ccc4[nH]ncc4c3)c3ccccc3c2=O)cc1OC |
| InChI | InChI=1S/C25H20N4O4/c1-32-22-10-8-17(12-23(22)33-2)29-24(30)19-6-4-3-5-18(19)20(25(29)31)14-26-16-7-9-21-15(11-16)13-27-28-21/h3-14,31H,1-2H3,(H,27,28)/b26-14+ |
| InChIKey | KCTZSJXBENLINO-VULFUBBASA-N |
| XLogP | 4.34 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|