C26H24N2O6 — CID 2426781
2-(3,4-dimethoxyphenyl)-4-[(3,5-dimethoxyphenyl)iminomethyl]-3-hydroxyisoquinolin-1-one (PubChem CID 2426781) has the molecular formula C26H24N2O6 and a molecular weight of 460.49 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-4-[(3,5-dimethoxyphenyl)iminomethyl]-3-hydroxyisoquinolin-1-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-4-[(3,5-dimethoxyphenyl)iminomethyl]-3-hydroxyisoquinolin-1-one |
|---|---|
| PubChem CID | 2426781 |
| Molecular Formula | C26H24N2O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-4-[(3,5-dimethoxyphenyl)iminomethyl]-3-hydroxyisoquinolin-1-one |
| SMILES | COc1cc(/N=C/c2c(O)n(-c3ccc(OC)c(OC)c3)c(=O)c3ccccc23)cc(OC)c1 |
| InChI | InChI=1S/C26H24N2O6/c1-31-18-11-16(12-19(14-18)32-2)27-15-22-20-7-5-6-8-21(20)25(29)28(26(22)30)17-9-10-23(33-3)24(13-17)34-4/h5-15,30H,1-4H3/b27-15+ |
| InChIKey | QZOZEMIDWRECBZ-JFLMPSFJSA-N |
| XLogP | 4.48 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|