C25H22N2O5 — CID 4897674
2-(2,5-dimethoxyphenyl)-3-hydroxy-4-[(4-methoxyphenyl)iminomethyl]isoquinolin-1-one (PubChem CID 4897674) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-3-hydroxy-4-[(4-methoxyphenyl)iminomethyl]isoquinolin-1-one.
| Compound Name | 2-(2,5-dimethoxyphenyl)-3-hydroxy-4-[(4-methoxyphenyl)iminomethyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 4897674 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-3-hydroxy-4-[(4-methoxyphenyl)iminomethyl]isoquinolin-1-one |
| SMILES | COc1ccc(/N=C/c2c(O)n(-c3cc(OC)ccc3OC)c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C25H22N2O5/c1-30-17-10-8-16(9-11-17)26-15-21-19-6-4-5-7-20(19)24(28)27(25(21)29)22-14-18(31-2)12-13-23(22)32-3/h4-15,29H,1-3H3/b26-15+ |
| InChIKey | DUMPEEVIVGWRCM-CVKSISIWSA-N |
| XLogP | 4.47 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|