C25H22N2O4 — CID 1212496
3-hydroxy-7-methoxy-2-(4-methoxyphenyl)-4-[(4-methylphenyl)iminomethyl]isoquinolin-1-one (PubChem CID 1212496) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is 3-hydroxy-7-methoxy-2-(4-methoxyphenyl)-4-[(4-methylphenyl)iminomethyl]isoquinolin-1-one.
| Compound Name | 3-hydroxy-7-methoxy-2-(4-methoxyphenyl)-4-[(4-methylphenyl)iminomethyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 1212496 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 3-hydroxy-7-methoxy-2-(4-methoxyphenyl)-4-[(4-methylphenyl)iminomethyl]isoquinolin-1-one |
| SMILES | COc1ccc(-n2c(O)c(/C=N/c3ccc(C)cc3)c3ccc(OC)cc3c2=O)cc1 |
| InChI | InChI=1S/C25H22N2O4/c1-16-4-6-17(7-5-16)26-15-23-21-13-12-20(31-3)14-22(21)24(28)27(25(23)29)18-8-10-19(30-2)11-9-18/h4-15,29H,1-3H3/b26-15+ |
| InChIKey | FSPWPBIZLKWDGD-CVKSISIWSA-N |
| XLogP | 4.77 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|