C23H19N3O4 — CID 2035561
2-(2,4-dimethoxyphenyl)-3-hydroxy-4-(pyridin-2-yliminomethyl)isoquinolin-1-one (PubChem CID 2035561) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-3-hydroxy-4-(pyridin-2-yliminomethyl)isoquinolin-1-one.
| Compound Name | 2-(2,4-dimethoxyphenyl)-3-hydroxy-4-(pyridin-2-yliminomethyl)isoquinolin-1-one |
|---|---|
| PubChem CID | 2035561 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-3-hydroxy-4-(pyridin-2-yliminomethyl)isoquinolin-1-one |
| SMILES | COc1ccc(-n2c(O)c(C=Nc3ccccn3)c3ccccc3c2=O)c(OC)c1 |
| InChI | InChI=1S/C23H19N3O4/c1-29-15-10-11-19(20(13-15)30-2)26-22(27)17-8-4-3-7-16(17)18(23(26)28)14-25-21-9-5-6-12-24-21/h3-14,28H,1-2H3 |
| InChIKey | DLLYOSUBNQBMJD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|