C28H27N3O4 — CID 2535688
2-(3,5-dimethylphenoxy)-N-[[2-(3,4-dimethylphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]acetamide (PubChem CID 2535688) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)-N-[[2-(3,4-dimethylphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]acetamide.
| Compound Name | 2-(3,5-dimethylphenoxy)-N-[[2-(3,4-dimethylphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 2535688 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)-N-[[2-(3,4-dimethylphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]acetamide |
| SMILES | Cc1cc(C)cc(OCC(=O)NN=Cc2c(O)n(-c3ccc(C)c(C)c3)c(=O)c3ccccc23)c1 |
| InChI | InChI=1S/C28H27N3O4/c1-17-11-18(2)13-22(12-17)35-16-26(32)30-29-15-25-23-7-5-6-8-24(23)27(33)31(28(25)34)21-10-9-19(3)20(4)14-21/h5-15,34H,16H2,1-4H3,(H,30,32) |
| InChIKey | CRDLIWHOQFOLOI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 92.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|