C29H31N3O4 — CID 135678655
2-(1-adamantyl)-N-[(E)-[3-hydroxy-2-(4-methoxyphenyl)-1-oxoisoquinolin-4-yl]methylideneamino]acetamide (PubChem CID 135678655) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[(E)-[3-hydroxy-2-(4-methoxyphenyl)-1-oxoisoquinolin-4-yl]methylideneamino]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[(E)-[3-hydroxy-2-(4-methoxyphenyl)-1-oxoisoquinolin-4-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 135678655 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 2-(1-adamantyl)-N-[(E)-[3-hydroxy-2-(4-methoxyphenyl)-1-oxoisoquinolin-4-yl]methylideneamino]acetamide |
| SMILES | COc1ccc(-n2c(O)c(/C=N/NC(=O)CC34CC5CC(CC(C5)C3)C4)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C29H31N3O4/c1-36-22-8-6-21(7-9-22)32-27(34)24-5-3-2-4-23(24)25(28(32)35)17-30-31-26(33)16-29-13-18-10-19(14-29)12-20(11-18)15-29/h2-9,17-20,35H,10-16H2,1H3,(H,31,33)/b30-17+ |
| InChIKey | RUSIMEZIJOUAAK-OCSSWDANSA-N |
| XLogP | 4.76 |
| TPSA | 92.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|