C22H29N3O4 — CID 9474937
2-(1-adamantyl)-N'-[2-[(Z)-(4-methoxyphenyl)methylideneamino]oxyacetyl]acetohydrazide (PubChem CID 9474937) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is 2-(1-adamantyl)-N'-[2-[(Z)-(4-methoxyphenyl)methylideneamino]oxyacetyl]acetohydrazide.
| Compound Name | 2-(1-adamantyl)-N'-[2-[(Z)-(4-methoxyphenyl)methylideneamino]oxyacetyl]acetohydrazide |
|---|---|
| PubChem CID | 9474937 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 2-(1-adamantyl)-N'-[2-[(Z)-(4-methoxyphenyl)methylideneamino]oxyacetyl]acetohydrazide |
| SMILES | COc1ccc(/C=N\OCC(=O)NNC(=O)CC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C22H29N3O4/c1-28-19-4-2-15(3-5-19)13-23-29-14-21(27)25-24-20(26)12-22-9-16-6-17(10-22)8-18(7-16)11-22/h2-5,13,16-18H,6-12,14H2,1H3,(H,24,26)(H,25,27)/b23-13- |
| InChIKey | ILAPTOIUNMEAPB-QRVIBDJDSA-N |
| XLogP | 2.80 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|