C21H28N2O4 — CID 24553914
N'-[2-(3-hydroxy-1-adamantyl)acetyl]-2-(4-methoxyphenyl)acetohydrazide (PubChem CID 24553914) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is N'-[2-(3-hydroxy-1-adamantyl)acetyl]-2-(4-methoxyphenyl)acetohydrazide.
| Compound Name | N'-[2-(3-hydroxy-1-adamantyl)acetyl]-2-(4-methoxyphenyl)acetohydrazide |
|---|---|
| PubChem CID | 24553914 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N'-[2-(3-hydroxy-1-adamantyl)acetyl]-2-(4-methoxyphenyl)acetohydrazide |
| SMILES | COc1ccc(CC(=O)NNC(=O)CC23CC4CC(CC(O)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C21H28N2O4/c1-27-17-4-2-14(3-5-17)7-18(24)22-23-19(25)12-20-8-15-6-16(9-20)11-21(26,10-15)13-20/h2-5,15-16,26H,6-13H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | ODLOSGOJWSDAOD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|