C20H18N4O6 — CID 71833687
2-(1,3-dioxoisoindol-2-yl)-N'-[2-[(4-methoxyphenyl)methylideneamino]oxyacetyl]acetohydrazide (PubChem CID 71833687) has the molecular formula C20H18N4O6 and a molecular weight of 410.39 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N'-[2-[(4-methoxyphenyl)methylideneamino]oxyacetyl]acetohydrazide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N'-[2-[(4-methoxyphenyl)methylideneamino]oxyacetyl]acetohydrazide |
|---|---|
| PubChem CID | 71833687 |
| Molecular Formula | C20H18N4O6 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N'-[2-[(4-methoxyphenyl)methylideneamino]oxyacetyl]acetohydrazide |
| SMILES | COc1ccc(C=NOCC(=O)NNC(=O)CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C20H18N4O6/c1-29-14-8-6-13(7-9-14)10-21-30-12-18(26)23-22-17(25)11-24-19(27)15-4-2-3-5-16(15)20(24)28/h2-10H,11-12H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | QTECYGOECHVYRP-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|