C17H21NO6 — CID 177443571
dimethyl (2R)-2-[2-[(E)-(4-methoxyphenyl)methylideneamino]oxyethyl]cyclopropane-1,1-dicarboxylate (PubChem CID 177443571) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is dimethyl (2R)-2-[2-[(E)-(4-methoxyphenyl)methylideneamino]oxyethyl]cyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl (2R)-2-[2-[(E)-(4-methoxyphenyl)methylideneamino]oxyethyl]cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 177443571 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | dimethyl (2R)-2-[2-[(E)-(4-methoxyphenyl)methylideneamino]oxyethyl]cyclopropane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@@H]1CCO/N=C/c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H21NO6/c1-21-14-6-4-12(5-7-14)11-18-24-9-8-13-10-17(13,15(19)22-2)16(20)23-3/h4-7,11,13H,8-10H2,1-3H3/b18-11+/t13-/m0/s1 |
| InChIKey | KQSBOVJZFTWXES-FHXOWUIVSA-N |
| XLogP | 1.79 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|