C23H19N3O5S — CID 135411409
N-[(E)-[3-hydroxy-2-(4-methoxyphenyl)-1-oxoisoquinolin-4-yl]methylideneamino]benzenesulfonamide (PubChem CID 135411409) has the molecular formula C23H19N3O5S and a molecular weight of 449.49 g/mol. Its IUPAC name is N-[(E)-[3-hydroxy-2-(4-methoxyphenyl)-1-oxoisoquinolin-4-yl]methylideneamino]benzenesulfonamide.
| Compound Name | N-[(E)-[3-hydroxy-2-(4-methoxyphenyl)-1-oxoisoquinolin-4-yl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 135411409 |
| Molecular Formula | C23H19N3O5S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | N-[(E)-[3-hydroxy-2-(4-methoxyphenyl)-1-oxoisoquinolin-4-yl]methylideneamino]benzenesulfonamide |
| SMILES | COc1ccc(-n2c(O)c(/C=N/NS(=O)(=O)c3ccccc3)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C23H19N3O5S/c1-31-17-13-11-16(12-14-17)26-22(27)20-10-6-5-9-19(20)21(23(26)28)15-24-25-32(29,30)18-7-3-2-4-8-18/h2-15,25,28H,1H3/b24-15+ |
| InChIKey | MATRDWJRRPQEEP-BUVRLJJBSA-N |
| XLogP | 3.02 |
| TPSA | 109.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|