C32H28N4O6S — CID 137264833
N-[(Z)-[2-(3,4-dimethylphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]-3-[(2-methoxyphenyl)sulfamoyl]benzamide (PubChem CID 137264833) has the molecular formula C32H28N4O6S and a molecular weight of 596.67 g/mol. Its IUPAC name is N-[(Z)-[2-(3,4-dimethylphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]-3-[(2-methoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-[(Z)-[2-(3,4-dimethylphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]-3-[(2-methoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 137264833 |
| Molecular Formula | C32H28N4O6S |
| Molecular Weight | 596.67 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | N-[(Z)-[2-(3,4-dimethylphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]-3-[(2-methoxyphenyl)sulfamoyl]benzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cccc(C(=O)N/N=C\c2c(O)n(-c3ccc(C)c(C)c3)c(=O)c3ccccc23)c1 |
| InChI | InChI=1S/C32H28N4O6S/c1-20-15-16-23(17-21(20)2)36-31(38)26-12-5-4-11-25(26)27(32(36)39)19-33-34-30(37)22-9-8-10-24(18-22)43(40,41)35-28-13-6-7-14-29(28)42-3/h4-19,35,39H,1-3H3,(H,34,37)/b33-19- |
| InChIKey | KVNIBTKRGJXYQV-APTWKGOFSA-N |
| XLogP | 4.89 |
| TPSA | 139.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.67 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|