C24H25N3O5S — CID 42991202
N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-3-[(2,4-dimethylphenyl)sulfamoyl]benzamide (PubChem CID 42991202) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-3-[(2,4-dimethylphenyl)sulfamoyl]benzamide.
| Compound Name | N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-3-[(2,4-dimethylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 42991202 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-3-[(2,4-dimethylphenyl)sulfamoyl]benzamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2cccc(S(=O)(=O)Nc3ccc(C)cc3C)c2)c(OC)c1 |
| InChI | InChI=1S/C24H25N3O5S/c1-16-8-11-22(17(2)12-16)27-33(29,30)21-7-5-6-18(13-21)24(28)26-25-15-19-9-10-20(31-3)14-23(19)32-4/h5-15,27H,1-4H3,(H,26,28)/b25-15+ |
| InChIKey | BGRVQTCDJMXVJV-MFKUBSTISA-N |
| XLogP | 3.89 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|