C28H28N4O4S — CID 2434148
N-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylideneamino]-3-[(4-methoxyphenyl)sulfamoyl]benzamide (PubChem CID 2434148) has the molecular formula C28H28N4O4S and a molecular weight of 516.62 g/mol. Its IUPAC name is N-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylideneamino]-3-[(4-methoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylideneamino]-3-[(4-methoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 2434148 |
| Molecular Formula | C28H28N4O4S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | N-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylideneamino]-3-[(4-methoxyphenyl)sulfamoyl]benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(C(=O)NN=Cc3cc(C)n(-c4ccc(C)cc4)c3C)c2)cc1 |
| InChI | InChI=1S/C28H28N4O4S/c1-19-8-12-25(13-9-19)32-20(2)16-23(21(32)3)18-29-30-28(33)22-6-5-7-27(17-22)37(34,35)31-24-10-14-26(36-4)15-11-24/h5-18,31H,1-4H3,(H,30,33) |
| InChIKey | IVTPLHTVXRVXJW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 101.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|