C27H25ClN4O4S — CID 6904566
N-[(E)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-[(4-methoxyphenyl)sulfamoyl]benzamide (PubChem CID 6904566) has the molecular formula C27H25ClN4O4S and a molecular weight of 537.04 g/mol. Its IUPAC name is N-[(E)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-[(4-methoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-[(E)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-[(4-methoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 6904566 |
| Molecular Formula | C27H25ClN4O4S |
| Molecular Weight | 537.04 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | N-[(E)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-[(4-methoxyphenyl)sulfamoyl]benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(C(=O)N/N=C/c3cc(C)n(-c4ccc(Cl)cc4)c3C)c2)cc1 |
| InChI | InChI=1S/C27H25ClN4O4S/c1-18-15-21(19(2)32(18)24-11-7-22(28)8-12-24)17-29-30-27(33)20-5-4-6-26(16-20)37(34,35)31-23-9-13-25(36-3)14-10-23/h4-17,31H,1-3H3,(H,30,33)/b29-17+ |
| InChIKey | MJGOUSIZQPCHBT-STBIYBPSSA-N |
| XLogP | 5.32 |
| TPSA | 101.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.04 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|