C30H30N4O6S — CID 6151506
ethyl 4-[3-[(Z)-[[3-[(4-methoxyphenyl)sulfamoyl]benzoyl]hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 6151506) has the molecular formula C30H30N4O6S and a molecular weight of 574.66 g/mol. Its IUPAC name is ethyl 4-[3-[(Z)-[[3-[(4-methoxyphenyl)sulfamoyl]benzoyl]hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[(Z)-[[3-[(4-methoxyphenyl)sulfamoyl]benzoyl]hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 6151506 |
| Molecular Formula | C30H30N4O6S |
| Molecular Weight | 574.66 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | ethyl 4-[3-[(Z)-[[3-[(4-methoxyphenyl)sulfamoyl]benzoyl]hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(C)cc(/C=N\NC(=O)c3cccc(S(=O)(=O)Nc4ccc(OC)cc4)c3)c2C)cc1 |
| InChI | InChI=1S/C30H30N4O6S/c1-5-40-30(36)22-9-13-26(14-10-22)34-20(2)17-24(21(34)3)19-31-32-29(35)23-7-6-8-28(18-23)41(37,38)33-25-11-15-27(39-4)16-12-25/h6-19,33H,5H2,1-4H3,(H,32,35)/b31-19- |
| InChIKey | YDVMAPAIPQGARN-DXJNIWACSA-N |
| XLogP | 4.84 |
| TPSA | 128.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.66 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|