C21H19N3O6S — CID 135852564
N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-3-[(4-methoxyphenyl)sulfamoyl]benzamide (PubChem CID 135852564) has the molecular formula C21H19N3O6S and a molecular weight of 441.47 g/mol. Its IUPAC name is N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-3-[(4-methoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-3-[(4-methoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 135852564 |
| Molecular Formula | C21H19N3O6S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-3-[(4-methoxyphenyl)sulfamoyl]benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(C(=O)N/N=C/c3ccc(O)c(O)c3)c2)cc1 |
| InChI | InChI=1S/C21H19N3O6S/c1-30-17-8-6-16(7-9-17)24-31(28,29)18-4-2-3-15(12-18)21(27)23-22-13-14-5-10-19(25)20(26)11-14/h2-13,24-26H,1H3,(H,23,27)/b22-13+ |
| InChIKey | PNJIGIIXDWOHIM-LPYMAVHISA-N |
| XLogP | 2.67 |
| TPSA | 137.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|