C19H15ClN4O3S — CID 6904494
3-[(4-chlorophenyl)sulfamoyl]-N-[(E)-pyridin-4-ylmethylideneamino]benzamide (PubChem CID 6904494) has the molecular formula C19H15ClN4O3S and a molecular weight of 414.87 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfamoyl]-N-[(E)-pyridin-4-ylmethylideneamino]benzamide.
| Compound Name | 3-[(4-chlorophenyl)sulfamoyl]-N-[(E)-pyridin-4-ylmethylideneamino]benzamide |
|---|---|
| PubChem CID | 6904494 |
| Molecular Formula | C19H15ClN4O3S |
| Molecular Weight | 414.87 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfamoyl]-N-[(E)-pyridin-4-ylmethylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1ccncc1)c1cccc(S(=O)(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H15ClN4O3S/c20-16-4-6-17(7-5-16)24-28(26,27)18-3-1-2-15(12-18)19(25)23-22-13-14-8-10-21-11-9-14/h1-13,24H,(H,23,25)/b22-13+ |
| InChIKey | KGKQERXOCXSQFN-LPYMAVHISA-N |
| XLogP | 3.30 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.87 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|