C26H23N3O4S — CID 3652547
3-[(2,4-dimethylphenyl)sulfamoyl]-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]benzamide (PubChem CID 3652547) has the molecular formula C26H23N3O4S and a molecular weight of 473.55 g/mol. Its IUPAC name is 3-[(2,4-dimethylphenyl)sulfamoyl]-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]benzamide.
| Compound Name | 3-[(2,4-dimethylphenyl)sulfamoyl]-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 3652547 |
| Molecular Formula | C26H23N3O4S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 3-[(2,4-dimethylphenyl)sulfamoyl]-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cccc(C(=O)NN=Cc3c(O)ccc4ccccc34)c2)c(C)c1 |
| InChI | InChI=1S/C26H23N3O4S/c1-17-10-12-24(18(2)14-17)29-34(32,33)21-8-5-7-20(15-21)26(31)28-27-16-23-22-9-4-3-6-19(22)11-13-25(23)30/h3-16,29-30H,1-2H3,(H,28,31) |
| InChIKey | MAPOMDBFOFEHRP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|