C28H25N3O2 — CID 137064419
3-(5,6-dimethyl-1,3-dihydroisoindol-2-yl)-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]benzamide (PubChem CID 137064419) has the molecular formula C28H25N3O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 3-(5,6-dimethyl-1,3-dihydroisoindol-2-yl)-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]benzamide.
| Compound Name | 3-(5,6-dimethyl-1,3-dihydroisoindol-2-yl)-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 137064419 |
| Molecular Formula | C28H25N3O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 3-(5,6-dimethyl-1,3-dihydroisoindol-2-yl)-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]benzamide |
| SMILES | Cc1cc2c(cc1C)CN(c1cccc(C(=O)N/N=C\c3c(O)ccc4ccccc34)c1)C2 |
| InChI | InChI=1S/C28H25N3O2/c1-18-12-22-16-31(17-23(22)13-19(18)2)24-8-5-7-21(14-24)28(33)30-29-15-26-25-9-4-3-6-20(25)10-11-27(26)32/h3-15,32H,16-17H2,1-2H3,(H,30,33)/b29-15- |
| InChIKey | QHQQBRZQAOKJMM-FDVSRXAVSA-N |
| XLogP | 5.45 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|