C26H19N3O4 — CID 135676051
2-[(E)-[2-(3,4-dimethylphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]isoindole-1,3-dione (PubChem CID 135676051) has the molecular formula C26H19N3O4 and a molecular weight of 437.46 g/mol. Its IUPAC name is 2-[(E)-[2-(3,4-dimethylphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]isoindole-1,3-dione.
| Compound Name | 2-[(E)-[2-(3,4-dimethylphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 135676051 |
| Molecular Formula | C26H19N3O4 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 2-[(E)-[2-(3,4-dimethylphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylideneamino]isoindole-1,3-dione |
| SMILES | Cc1ccc(-n2c(O)c(/C=N/N3C(=O)c4ccccc4C3=O)c3ccccc3c2=O)cc1C |
| InChI | InChI=1S/C26H19N3O4/c1-15-11-12-17(13-16(15)2)28-23(30)19-8-4-3-7-18(19)22(24(28)31)14-27-29-25(32)20-9-5-6-10-21(20)26(29)33/h3-14,31H,1-2H3/b27-14+ |
| InChIKey | MNEWIKJLRJNSMR-MZJWZYIUSA-N |
| XLogP | 3.94 |
| TPSA | 91.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|